C13H18N2O2 — CID 104901084
(2R)-N-[2-(1-hydroxyethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 104901084) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2R)-N-[2-(1-hydroxyethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(1-hydroxyethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104901084 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2R)-N-[2-(1-hydroxyethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC(O)c1ccccc1NC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(16)10-5-2-3-6-11(10)15-13(17)12-7-4-8-14-12/h2-3,5-6,9,12,14,16H,4,7-8H2,1H3,(H,15,17)/t9?,12-/m1/s1 |
| InChIKey | UWUORWJPIJCUNZ-FFFFSGIJSA-N |
| XLogP | 1.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |