C10H20F2N2O2 — CID 10490109
(3R,4S)-4-amino-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide (PubChem CID 10490109) has the molecular formula C10H20F2N2O2 and a molecular weight of 238.28 g/mol. Its IUPAC name is (3R,4S)-4-amino-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide.
| Compound Name | (3R,4S)-4-amino-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide |
|---|---|
| PubChem CID | 10490109 |
| Molecular Formula | C10H20F2N2O2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (3R,4S)-4-amino-2,2-difluoro-3-hydroxy-5-methyl-N-propylhexanamide |
| SMILES | CCCNC(=O)C(F)(F)[C@H](O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C10H20F2N2O2/c1-4-5-14-9(16)10(11,12)8(15)7(13)6(2)3/h6-8,15H,4-5,13H2,1-3H3,(H,14,16)/t7-,8+/m0/s1 |
| InChIKey | GEZXFNHAYREYMA-JGVFFNPUSA-N |
| XLogP | 0.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |