C15H16N2O — CID 10490231
(Z)-3-(4,5-dimethyl-3,6-dihydrooxazin-2-yl)-3-phenylprop-2-enenitrile (PubChem CID 10490231) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is (Z)-3-(4,5-dimethyl-3,6-dihydrooxazin-2-yl)-3-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-(4,5-dimethyl-3,6-dihydrooxazin-2-yl)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 10490231 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (Z)-3-(4,5-dimethyl-3,6-dihydrooxazin-2-yl)-3-phenylprop-2-enenitrile |
| SMILES | CC1=C(C)CN(/C(=C\C#N)c2ccccc2)OC1 |
| InChI | InChI=1S/C15H16N2O/c1-12-10-17(18-11-13(12)2)15(8-9-16)14-6-4-3-5-7-14/h3-8H,10-11H2,1-2H3/b15-8- |
| InChIKey | GKAMNAXEAKNJIL-NVNXTCNLSA-N |
| XLogP | 3.13 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|