About 8,10-dimethylbenzo[g]pteridine-2,4-dione
8,10-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 10490335) has the molecular formula C12H10N4O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 8,10-dimethylbenzo[g]pteridine-2,4-dione.
Molecular Properties
| Compound Name | 8,10-dimethylbenzo[g]pteridine-2,4-dione |
| PubChem CID | 10490335 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 8,10-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1ccc2nc3c(=O)[nH]c(=O)nc-3n(C)c2c1 |
| InChI | InChI=1S/C12H10N4O2/c1-6-3-4-7-8(5-6)16(2)10-9(13-7)11(17)15-12(18)14-10/h3-5H,1-2H3,(H,15,17,18) |
| InChIKey | LPXRFVYSHPRVAO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8,10-dimethylbenzo[g]pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,10-dimethylbenzo[g]pteridine-2,4-dione?
The IUPAC name of 8,10-dimethylbenzo[g]pteridine-2,4-dione (CID 10490335) is 8,10-dimethylbenzo[g]pteridine-2,4-dione.
What is the SMILES notation for 8,10-dimethylbenzo[g]pteridine-2,4-dione?
The canonical SMILES for 8,10-dimethylbenzo[g]pteridine-2,4-dione is Cc1ccc2nc3c(=O)[nH]c(=O)nc-3n(C)c2c1.
What is the InChIKey of 8,10-dimethylbenzo[g]pteridine-2,4-dione?
The InChIKey is LPXRFVYSHPRVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2/c1-6-3-4-7-8(5-6)16(2)10-9(13-7)11(17)15-12(18)14-10/h3-5H,1-2H3,(H,15,17,18).
What are the key properties of 8,10-dimethylbenzo[g]pteridine-2,4-dione?
8,10-dimethylbenzo[g]pteridine-2,4-dione has a molecular weight of 242.24 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8,10-dimethylbenzo[g]pteridine-2,4-dione is sourced from PubChem (CID 10490335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).