C18H10O — CID 10490347
pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,4,6,8,11,13(18),14,16-nonaen-5-ol (PubChem CID 10490347) has the molecular formula C18H10O and a molecular weight of 242.28 g/mol. Its IUPAC name is pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,4,6,8,11,13(18),14,16-nonaen-5-ol.
| Compound Name | pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,4,6,8,11,13(18),14,16-nonaen-5-ol |
|---|---|
| PubChem CID | 10490347 |
| Molecular Formula | C18H10O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,4,6,8,11,13(18),14,16-nonaen-5-ol |
| SMILES | Oc1cc2c3c(ccc4ccc5cccc-2c5c43)c1 |
| InChI | InChI=1S/C18H10O/c19-13-8-12-7-6-11-5-4-10-2-1-3-14-15(9-13)17(12)18(11)16(10)14/h1-9,19H |
| InChIKey | SCJAQVFYSVALQM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|