C13H24N2O4 — CID 104903845
4-[[[(2R)-2-amino-4-methylpentanoyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 104903845) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-[[[(2R)-2-amino-4-methylpentanoyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[(2R)-2-amino-4-methylpentanoyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 104903845 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 4-[[[(2R)-2-amino-4-methylpentanoyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | CC(C)C[C@@H](N)C(=O)NCC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C13H24N2O4/c1-9(2)7-10(14)11(16)15-8-13(12(17)18)3-5-19-6-4-13/h9-10H,3-8,14H2,1-2H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | MVLQXBPICOPABW-SNVBAGLBSA-N |
| XLogP | 0.36 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |