About 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one
1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one (PubChem CID 10490395) has the molecular formula C11H8Cl2O2
and a molecular weight of 243.09 g/mol. Its IUPAC name is 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one.
Molecular Properties
| Compound Name | 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one |
| PubChem CID | 10490395 |
| Molecular Formula | C11H8Cl2O2 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one |
| SMILES | O=C1OC2Cc3ccccc3C2C1(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O2/c12-11(13)9-7-4-2-1-3-6(7)5-8(9)15-10(11)14/h1-4,8-9H,5H2 |
| InChIKey | MKUSZVAKHXILGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one?
The IUPAC name of 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one (CID 10490395) is 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one.
What is the SMILES notation for 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one?
The canonical SMILES for 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one is O=C1OC2Cc3ccccc3C2C1(Cl)Cl.
What is the InChIKey of 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one?
The InChIKey is MKUSZVAKHXILGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2O2/c12-11(13)9-7-4-2-1-3-6(7)5-8(9)15-10(11)14/h1-4,8-9H,5H2.
What are the key properties of 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one?
1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one has a molecular weight of 243.09 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-4,8b-dihydro-3aH-indeno[2,1-b]furan-2-one is sourced from PubChem (CID 10490395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).