C11H17NO3S — CID 10490437
N-(furan-2-ylmethyl)-N-prop-2-enylpropane-2-sulfonamide (PubChem CID 10490437) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-prop-2-enylpropane-2-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-prop-2-enylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 10490437 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-prop-2-enylpropane-2-sulfonamide |
| SMILES | C=CCN(Cc1ccco1)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H17NO3S/c1-4-7-12(16(13,14)10(2)3)9-11-6-5-8-15-11/h4-6,8,10H,1,7,9H2,2-3H3 |
| InChIKey | FZLWYQUXLHGVDW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|