C13H18N4 — CID 104904387
(1R)-3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)butan-1-amine (PubChem CID 104904387) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is (1R)-3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)butan-1-amine.
| Compound Name | (1R)-3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 104904387 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (1R)-3-methyl-1-(3-phenyl-1H-1,2,4-triazol-5-yl)butan-1-amine |
| SMILES | CC(C)C[C@@H](N)c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C13H18N4/c1-9(2)8-11(14)13-15-12(16-17-13)10-6-4-3-5-7-10/h3-7,9,11H,8,14H2,1-2H3,(H,15,16,17)/t11-/m1/s1 |
| InChIKey | FPRNCQIKYWXJEF-LLVKDONJSA-N |
| XLogP | 2.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |