About tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate
tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate (PubChem CID 10490440) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate |
| PubChem CID | 10490440 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate |
| SMILES | C=C[C@H](O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-7-11(15)10(8-9(2)3)14-12(16)17-13(4,5)6/h7,9-11,15H,1,8H2,2-6H3,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | HFORXYBQJVPDTQ-QWRGUYRKSA-N |
| XLogP | 2.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate (CID 10490440) is tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate is C=C[C@H](O)[C@H](CC(C)C)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate?
The InChIKey is HFORXYBQJVPDTQ-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H25NO3/c1-7-11(15)10(8-9(2)3)14-12(16)17-13(4,5)6/h7,9-11,15H,1,8H2,2-6H3,(H,14,16)/t10-,11-/m0/s1.
What are the key properties of tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate?
tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate has a molecular weight of 243.35 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S,4S)-3-hydroxy-6-methylhept-1-en-4-yl]carbamate is sourced from PubChem (CID 10490440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).