C12H20O5 — CID 10490479
[(3aS,7R,7aR)-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol (PubChem CID 10490479) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [(3aS,7R,7aR)-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 10490479 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(3aS,7R,7aR)-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxol-5-yl]methanol |
| SMILES | COCO[C@@H]1CC(CO)=C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H20O5/c1-12(2)16-10-5-8(6-13)4-9(11(10)17-12)15-7-14-3/h5,9-11,13H,4,6-7H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | FBTPSLOVLLCJSZ-OUAUKWLOSA-N |
| XLogP | 0.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|