C15H22N2O4 — CID 104904819
methyl (2S)-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoate (PubChem CID 104904819) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (2S)-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 104904819 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | methyl (2S)-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)C(N)Cc1ccc(O)cc1)C(C)C |
| InChI | InChI=1S/C15H22N2O4/c1-9(2)13(15(20)21-3)17-14(19)12(16)8-10-4-6-11(18)7-5-10/h4-7,9,12-13,18H,8,16H2,1-3H3,(H,17,19)/t12?,13-/m0/s1 |
| InChIKey | FBTZPRIAPPEAHD-ABLWVSNPSA-N |
| XLogP | 0.58 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |