C13H20N2O4 — CID 104904975
(2R)-2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 104904975) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2R)-2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 104904975 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2R)-2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | N[C@H](Cc1ccc(O)cc1)C(=O)NCCOCCO |
| InChI | InChI=1S/C13H20N2O4/c14-12(9-10-1-3-11(17)4-2-10)13(18)15-5-7-19-8-6-16/h1-4,12,16-17H,5-9,14H2,(H,15,18)/t12-/m1/s1 |
| InChIKey | OCIQSYVWZYXAPN-GFCCVEGCSA-N |
| XLogP | -0.61 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|