C17H24O — CID 10490517
(1R,2S,5R)-1,4-dimethyl-2-(2-methylcyclopenten-1-yl)-8-methylidenebicyclo[3.2.1]oct-3-en-2-ol (PubChem CID 10490517) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R,2S,5R)-1,4-dimethyl-2-(2-methylcyclopenten-1-yl)-8-methylidenebicyclo[3.2.1]oct-3-en-2-ol.
| Compound Name | (1R,2S,5R)-1,4-dimethyl-2-(2-methylcyclopenten-1-yl)-8-methylidenebicyclo[3.2.1]oct-3-en-2-ol |
|---|---|
| PubChem CID | 10490517 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1R,2S,5R)-1,4-dimethyl-2-(2-methylcyclopenten-1-yl)-8-methylidenebicyclo[3.2.1]oct-3-en-2-ol |
| SMILES | C=C1[C@@H]2CC[C@@]1(C)[C@@](O)(C1=C(C)CCC1)C=C2C |
| InChI | InChI=1S/C17H24O/c1-11-6-5-7-15(11)17(18)10-12(2)14-8-9-16(17,4)13(14)3/h10,14,18H,3,5-9H2,1-2,4H3/t14-,16-,17+/m1/s1 |
| InChIKey | WPFWONIFABWKTF-OIISXLGYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|