C13H25N2+ — CID 10490549
N,1-ditert-butyl-3-methyl-2H-pyrrol-1-ium-5-amine (PubChem CID 10490549) has the molecular formula C13H25N2+ and a molecular weight of 209.36 g/mol. Its IUPAC name is N,1-ditert-butyl-3-methyl-2H-pyrrol-1-ium-5-amine.
| Compound Name | N,1-ditert-butyl-3-methyl-2H-pyrrol-1-ium-5-amine |
|---|---|
| PubChem CID | 10490549 |
| Molecular Formula | C13H25N2+ |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.20 |
| IUPAC Name | N,1-ditert-butyl-3-methyl-2H-pyrrol-1-ium-5-amine |
| SMILES | CC1=CC(NC(C)(C)C)=[N+](C(C)(C)C)C1 |
| InChI | InChI=1S/C13H24N2/c1-10-8-11(14-12(2,3)4)15(9-10)13(5,6)7/h8H,9H2,1-7H3/p+1 |
| InChIKey | YMZFGSCBLSYVSA-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|