C15H18O3 — CID 10490644
(3R,3aR,4R)-4-hydroxy-3,3a,5,5-tetramethyl-4,7-dihydro-3H-cyclopenta[a]pentalene-2,6-dione (PubChem CID 10490644) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3R,3aR,4R)-4-hydroxy-3,3a,5,5-tetramethyl-4,7-dihydro-3H-cyclopenta[a]pentalene-2,6-dione.
| Compound Name | (3R,3aR,4R)-4-hydroxy-3,3a,5,5-tetramethyl-4,7-dihydro-3H-cyclopenta[a]pentalene-2,6-dione |
|---|---|
| PubChem CID | 10490644 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3R,3aR,4R)-4-hydroxy-3,3a,5,5-tetramethyl-4,7-dihydro-3H-cyclopenta[a]pentalene-2,6-dione |
| SMILES | C[C@H]1C(=O)C=C2CC3=C([C@@H](O)C(C)(C)C3=O)[C@@]21C |
| InChI | InChI=1S/C15H18O3/c1-7-10(16)6-8-5-9-11(15(7,8)4)13(18)14(2,3)12(9)17/h6-7,13,18H,5H2,1-4H3/t7-,13+,15+/m0/s1 |
| InChIKey | ZJQBSHFABOKMJU-SBPMXOOQSA-N |
| XLogP | 1.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |