About 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol
1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol (PubChem CID 10490728) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol.
Molecular Properties
| Compound Name | 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol |
| PubChem CID | 10490728 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol |
| SMILES | CCCN1CCCC12COc1cccc(O)c1C2 |
| InChI | InChI=1S/C15H21NO2/c1-2-8-16-9-4-7-15(16)10-12-13(17)5-3-6-14(12)18-11-15/h3,5-6,17H,2,4,7-11H2,1H3 |
| InChIKey | SHUXJMKMECCNTK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol?
The IUPAC name of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol (CID 10490728) is 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol.
What is the SMILES notation for 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol?
The canonical SMILES for 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol is CCCN1CCCC12COc1cccc(O)c1C2.
What is the InChIKey of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol?
The InChIKey is SHUXJMKMECCNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-2-8-16-9-4-7-15(16)10-12-13(17)5-3-6-14(12)18-11-15/h3,5-6,17H,2,4,7-11H2,1H3.
What are the key properties of 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol?
1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol has a molecular weight of 247.34 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propylspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-5-ol is sourced from PubChem (CID 10490728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).