C13H17FN2O3S — CID 104907468
methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-fluorobenzoate (PubChem CID 104907468) has the molecular formula C13H17FN2O3S and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-fluorobenzoate.
| Compound Name | methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 104907468 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | methyl 2-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)cc1NC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C13H17FN2O3S/c1-19-13(18)9-4-3-8(14)7-11(9)16-12(17)10(15)5-6-20-2/h3-4,7,10H,5-6,15H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | YIGVONLZVYOFBY-SNVBAGLBSA-N |
| XLogP | 1.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |