About 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane
3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane (PubChem CID 10490762) has the molecular formula C11H11F3OS
and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane.
Molecular Properties
| Compound Name | 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane |
| PubChem CID | 10490762 |
| Molecular Formula | C11H11F3OS |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane |
| SMILES | FC(F)(F)c1ccccc1C1COCCS1 |
| InChI | InChI=1S/C11H11F3OS/c12-11(13,14)9-4-2-1-3-8(9)10-7-15-5-6-16-10/h1-4,10H,5-7H2 |
| InChIKey | PGUOBUPAZSZHIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane?
The IUPAC name of 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane (CID 10490762) is 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane.
What is the SMILES notation for 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane?
The canonical SMILES for 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane is FC(F)(F)c1ccccc1C1COCCS1.
What is the InChIKey of 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane?
The InChIKey is PGUOBUPAZSZHIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3OS/c12-11(13,14)9-4-2-1-3-8(9)10-7-15-5-6-16-10/h1-4,10H,5-7H2.
What are the key properties of 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane?
3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane has a molecular weight of 248.27 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(trifluoromethyl)phenyl]-1,4-oxathiane is sourced from PubChem (CID 10490762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).