C15H22O3 — CID 10490922
methyl (4aR,4bS,8aS,8bS)-4b-methyl-8-oxo-2,3,4,5,6,7,8a,8b-octahydro-1H-biphenylene-4a-carboxylate (PubChem CID 10490922) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (4aR,4bS,8aS,8bS)-4b-methyl-8-oxo-2,3,4,5,6,7,8a,8b-octahydro-1H-biphenylene-4a-carboxylate.
| Compound Name | methyl (4aR,4bS,8aS,8bS)-4b-methyl-8-oxo-2,3,4,5,6,7,8a,8b-octahydro-1H-biphenylene-4a-carboxylate |
|---|---|
| PubChem CID | 10490922 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (4aR,4bS,8aS,8bS)-4b-methyl-8-oxo-2,3,4,5,6,7,8a,8b-octahydro-1H-biphenylene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCCC[C@H]1[C@@H]1C(=O)CCC[C@@]12C |
| InChI | InChI=1S/C15H22O3/c1-14-8-5-7-11(16)12(14)10-6-3-4-9-15(10,14)13(17)18-2/h10,12H,3-9H2,1-2H3/t10-,12+,14-,15-/m0/s1 |
| InChIKey | CONOPPABBMKGPG-FDEJFUCISA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |