C11H15F3O3 — CID 10491002
[(1R,4R)-4-propan-2-yloxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate (PubChem CID 10491002) has the molecular formula C11H15F3O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is [(1R,4R)-4-propan-2-yloxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,4R)-4-propan-2-yloxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10491002 |
| Molecular Formula | C11H15F3O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(1R,4R)-4-propan-2-yloxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)O[C@H]1C=C[C@H](OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3O3/c1-7(2)16-8-3-5-9(6-4-8)17-10(15)11(12,13)14/h3,5,7-9H,4,6H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | USYAMQBTROWBMU-IUCAKERBSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|