About (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol
(5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol (PubChem CID 104911614) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol |
| PubChem CID | 104911614 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol |
| SMILES | Nc1n[nH]c([C@@H]2CC(O)CN2)n1 |
| InChI | InChI=1S/C6H11N5O/c7-6-9-5(10-11-6)4-1-3(12)2-8-4/h3-4,8,12H,1-2H2,(H3,7,9,10,11)/t3?,4-/m0/s1 |
| InChIKey | MCCOXKMEEUNUFG-BKLSDQPFSA-N |
| XLogP | -1.22 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
The IUPAC name of (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol (CID 104911614) is (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol.
What is the SMILES notation for (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
The canonical SMILES for (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol is Nc1n[nH]c([C@@H]2CC(O)CN2)n1.
What is the InChIKey of (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
The InChIKey is MCCOXKMEEUNUFG-BKLSDQPFSA-N. The full InChI is InChI=1S/C6H11N5O/c7-6-9-5(10-11-6)4-1-3(12)2-8-4/h3-4,8,12H,1-2H2,(H3,7,9,10,11)/t3?,4-/m0/s1.
What are the key properties of (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
(5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol has a molecular weight of 169.19 g/mol, XLogP of -1.22, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(3-amino-1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol is sourced from PubChem (CID 104911614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).