About (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol
(5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol (PubChem CID 104911665) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol |
| PubChem CID | 104911665 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol |
| SMILES | OC1CN[C@H](c2ncn[nH]2)C1 |
| InChI | InChI=1S/C6H10N4O/c11-4-1-5(7-2-4)6-8-3-9-10-6/h3-5,7,11H,1-2H2,(H,8,9,10)/t4?,5-/m0/s1 |
| InChIKey | YWUFTFLNKNKHSF-AKGZTFGVSA-N |
| XLogP | -0.80 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
The IUPAC name of (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol (CID 104911665) is (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol.
What is the SMILES notation for (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
The canonical SMILES for (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol is OC1CN[C@H](c2ncn[nH]2)C1.
What is the InChIKey of (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
The InChIKey is YWUFTFLNKNKHSF-AKGZTFGVSA-N. The full InChI is InChI=1S/C6H10N4O/c11-4-1-5(7-2-4)6-8-3-9-10-6/h3-5,7,11H,1-2H2,(H,8,9,10)/t4?,5-/m0/s1.
What are the key properties of (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol?
(5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol has a molecular weight of 154.17 g/mol, XLogP of -0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(1H-1,2,4-triazol-5-yl)pyrrolidin-3-ol is sourced from PubChem (CID 104911665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).