C14H22O4 — CID 10491167
methyl (1R,2S,5S,6S,8R)-2-hydroxy-10,10-dimethyl-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate (PubChem CID 10491167) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl (1R,2S,5S,6S,8R)-2-hydroxy-10,10-dimethyl-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate.
| Compound Name | methyl (1R,2S,5S,6S,8R)-2-hydroxy-10,10-dimethyl-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate |
|---|---|
| PubChem CID | 10491167 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl (1R,2S,5S,6S,8R)-2-hydroxy-10,10-dimethyl-3-oxatricyclo[6.3.0.01,5]undecane-6-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]2CC(C)(C)C[C@@]23[C@@H](O)OC[C@@H]13 |
| InChI | InChI=1S/C14H22O4/c1-13(2)5-8-4-9(11(15)17-3)10-6-18-12(16)14(8,10)7-13/h8-10,12,16H,4-7H2,1-3H3/t8-,9+,10+,12+,14-/m1/s1 |
| InChIKey | CWRZGDYDZSFYKP-MTTQLMSHSA-N |
| XLogP | 1.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |