C15H26O3 — CID 10491184
(1S,2R,4S,5S,7S,8R,9R,11R)-2,6,6,11-tetramethyltricyclo[5.4.0.02,8]undecane-4,5,9-triol (PubChem CID 10491184) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2R,4S,5S,7S,8R,9R,11R)-2,6,6,11-tetramethyltricyclo[5.4.0.02,8]undecane-4,5,9-triol.
| Compound Name | (1S,2R,4S,5S,7S,8R,9R,11R)-2,6,6,11-tetramethyltricyclo[5.4.0.02,8]undecane-4,5,9-triol |
|---|---|
| PubChem CID | 10491184 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2R,4S,5S,7S,8R,9R,11R)-2,6,6,11-tetramethyltricyclo[5.4.0.02,8]undecane-4,5,9-triol |
| SMILES | C[C@@H]1C[C@@H](O)[C@@H]2[C@@H]3[C@H]1[C@@]2(C)C[C@H](O)[C@@H](O)C3(C)C |
| InChI | InChI=1S/C15H26O3/c1-7-5-8(16)11-12-10(7)15(11,4)6-9(17)13(18)14(12,2)3/h7-13,16-18H,5-6H2,1-4H3/t7-,8-,9+,10+,11-,12+,13-,15-/m1/s1 |
| InChIKey | WAQKPMHCWWMALU-RVBRGJKHSA-N |
| XLogP | 1.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |