C14H22O2S — CID 10491187
(1E,5E,9E)-1-(methylsulfonylmethyl)cyclododeca-1,5,9-triene (PubChem CID 10491187) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is (1E,5E,9E)-1-(methylsulfonylmethyl)cyclododeca-1,5,9-triene.
| Compound Name | (1E,5E,9E)-1-(methylsulfonylmethyl)cyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 10491187 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1E,5E,9E)-1-(methylsulfonylmethyl)cyclododeca-1,5,9-triene |
| SMILES | CS(=O)(=O)C/C1=C/CC/C=C/CC/C=C/CC1 |
| InChI | InChI=1S/C14H22O2S/c1-17(15,16)13-14-11-9-7-5-3-2-4-6-8-10-12-14/h3,5-6,8,11H,2,4,7,9-10,12-13H2,1H3/b5-3+,8-6+,14-11+ |
| InChIKey | MTVUQXNUEIHSRK-MHCTUBSLSA-N |
| XLogP | 3.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|