C14H23N3O3 — CID 104912084
3-(4-ethoxyoxan-4-yl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 104912084) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-(4-ethoxyoxan-4-yl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-ethoxyoxan-4-yl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104912084 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-(4-ethoxyoxan-4-yl)-5-[(3R)-piperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CCOC1(c2noc([C@@H]3CCCNC3)n2)CCOCC1 |
| InChI | InChI=1S/C14H23N3O3/c1-2-19-14(5-8-18-9-6-14)13-16-12(20-17-13)11-4-3-7-15-10-11/h11,15H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | MZXLGIALMNNTJF-LLVKDONJSA-N |
| XLogP | 1.58 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |