About (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial
(2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial (PubChem CID 10491464) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial.
Molecular Properties
| Compound Name | (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial |
| PubChem CID | 10491464 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial |
| SMILES | CC(C=O)C(O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C13H26O3Si/c1-10(8-14)12(11(2)9-15)16-17(6,7)13(3,4)5/h8-12H,1-7H3/t10-,11?,12?/m1/s1 |
| InChIKey | ONPODEWCTSAKCB-VOMCLLRMSA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial?
The IUPAC name of (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial (CID 10491464) is (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial.
What is the SMILES notation for (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial?
The canonical SMILES for (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial is CC(C=O)C(O[Si](C)(C)C(C)(C)C)[C@H](C)C=O.
What is the InChIKey of (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial?
The InChIKey is ONPODEWCTSAKCB-VOMCLLRMSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-10(8-14)12(11(2)9-15)16-17(6,7)13(3,4)5/h8-12H,1-7H3/t10-,11?,12?/m1/s1.
What are the key properties of (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial?
(2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial has a molecular weight of 258.43 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentanedial is sourced from PubChem (CID 10491464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).