C10H17N3O2 — CID 104915006
3-(ethoxymethyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole (PubChem CID 104915006) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(ethoxymethyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(ethoxymethyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104915006 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-(ethoxymethyl)-5-[(2R)-piperidin-2-yl]-1,2,4-oxadiazole |
| SMILES | CCOCc1noc([C@H]2CCCCN2)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-2-14-7-9-12-10(15-13-9)8-5-3-4-6-11-8/h8,11H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | IIWWRPXMUVFVFD-MRVPVSSYSA-N |
| XLogP | 1.42 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |