About azepan-1-yl-(2,2-dimethylcyclopentyl)methanone
azepan-1-yl-(2,2-dimethylcyclopentyl)methanone (PubChem CID 104916412) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is azepan-1-yl-(2,2-dimethylcyclopentyl)methanone.
Molecular Properties
| Compound Name | azepan-1-yl-(2,2-dimethylcyclopentyl)methanone |
| PubChem CID | 104916412 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | azepan-1-yl-(2,2-dimethylcyclopentyl)methanone |
| SMILES | CC1(C)CCCC1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H25NO/c1-14(2)9-7-8-12(14)13(16)15-10-5-3-4-6-11-15/h12H,3-11H2,1-2H3 |
| InChIKey | NSDPIBPTSLIGRN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azepan-1-yl-(2,2-dimethylcyclopentyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-(2,2-dimethylcyclopentyl)methanone?
The IUPAC name of azepan-1-yl-(2,2-dimethylcyclopentyl)methanone (CID 104916412) is azepan-1-yl-(2,2-dimethylcyclopentyl)methanone.
What is the SMILES notation for azepan-1-yl-(2,2-dimethylcyclopentyl)methanone?
The canonical SMILES for azepan-1-yl-(2,2-dimethylcyclopentyl)methanone is CC1(C)CCCC1C(=O)N1CCCCCC1.
What is the InChIKey of azepan-1-yl-(2,2-dimethylcyclopentyl)methanone?
The InChIKey is NSDPIBPTSLIGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-14(2)9-7-8-12(14)13(16)15-10-5-3-4-6-11-15/h12H,3-11H2,1-2H3.
What are the key properties of azepan-1-yl-(2,2-dimethylcyclopentyl)methanone?
azepan-1-yl-(2,2-dimethylcyclopentyl)methanone has a molecular weight of 223.36 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-(2,2-dimethylcyclopentyl)methanone is sourced from PubChem (CID 104916412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).