About ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate
ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate (PubChem CID 104916694) has the molecular formula C13H26N2O5S
and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate |
| PubChem CID | 104916694 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NCCCNS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O5S/c1-6-20-12(17)10(13(2,3)4)11(16)14-8-7-9-15-21(5,18)19/h10,15H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | IICYRHBOFWXISB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate?
The IUPAC name of ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate (CID 104916694) is ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate is CCOC(=O)C(C(=O)NCCCNS(C)(=O)=O)C(C)(C)C.
What is the InChIKey of ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate?
The InChIKey is IICYRHBOFWXISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O5S/c1-6-20-12(17)10(13(2,3)4)11(16)14-8-7-9-15-21(5,18)19/h10,15H,6-9H2,1-5H3,(H,14,16).
What are the key properties of ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate?
ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate has a molecular weight of 322.43 g/mol, XLogP of 0.27, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(methanesulfonamido)propylcarbamoyl]-3,3-dimethylbutanoate is sourced from PubChem (CID 104916694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).