About [(2E)-4-iodopenta-2,4-dienyl]cyclopentane
[(2E)-4-iodopenta-2,4-dienyl]cyclopentane (PubChem CID 10491684) has the molecular formula C10H15I
and a molecular weight of 262.13 g/mol. Its IUPAC name is [(2E)-4-iodopenta-2,4-dienyl]cyclopentane.
Molecular Properties
| Compound Name | [(2E)-4-iodopenta-2,4-dienyl]cyclopentane |
| PubChem CID | 10491684 |
| Molecular Formula | C10H15I |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | [(2E)-4-iodopenta-2,4-dienyl]cyclopentane |
| SMILES | C=C(I)/C=C/CC1CCCC1 |
| InChI | InChI=1S/C10H15I/c1-9(11)5-4-8-10-6-2-3-7-10/h4-5,10H,1-3,6-8H2/b5-4+ |
| InChIKey | CPWUELZMMKXXTK-SNAWJCMRSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-4-iodopenta-2,4-dienyl]cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-4-iodopenta-2,4-dienyl]cyclopentane?
The IUPAC name of [(2E)-4-iodopenta-2,4-dienyl]cyclopentane (CID 10491684) is [(2E)-4-iodopenta-2,4-dienyl]cyclopentane.
What is the SMILES notation for [(2E)-4-iodopenta-2,4-dienyl]cyclopentane?
The canonical SMILES for [(2E)-4-iodopenta-2,4-dienyl]cyclopentane is C=C(I)/C=C/CC1CCCC1.
What is the InChIKey of [(2E)-4-iodopenta-2,4-dienyl]cyclopentane?
The InChIKey is CPWUELZMMKXXTK-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H15I/c1-9(11)5-4-8-10-6-2-3-7-10/h4-5,10H,1-3,6-8H2/b5-4+.
What are the key properties of [(2E)-4-iodopenta-2,4-dienyl]cyclopentane?
[(2E)-4-iodopenta-2,4-dienyl]cyclopentane has a molecular weight of 262.13 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-4-iodopenta-2,4-dienyl]cyclopentane is sourced from PubChem (CID 10491684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).