C14H17NO4 — CID 10491781
(2E,4E)-N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)hexa-2,4-dienamide (PubChem CID 10491781) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2E,4E)-N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 10491781 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2E,4E)-N-(6,6-dimethoxy-3-oxocyclohexa-1,4-dien-1-yl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NC1=CC(=O)C=CC1(OC)OC |
| InChI | InChI=1S/C14H17NO4/c1-4-5-6-7-13(17)15-12-10-11(16)8-9-14(12,18-2)19-3/h4-10H,1-3H3,(H,15,17)/b5-4+,7-6+ |
| InChIKey | SEMYIMKTFBYJRD-YTXTXJHMSA-N |
| XLogP | 1.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|