About ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate
ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate (PubChem CID 104918063) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate |
| PubChem CID | 104918063 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NCC1(CC)CC1)C(C)(C)C |
| InChI | InChI=1S/C15H27NO3/c1-6-15(8-9-15)10-16-12(17)11(14(3,4)5)13(18)19-7-2/h11H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | YMHLYWPCYONABV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate?
The IUPAC name of ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate (CID 104918063) is ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate is CCOC(=O)C(C(=O)NCC1(CC)CC1)C(C)(C)C.
What is the InChIKey of ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate?
The InChIKey is YMHLYWPCYONABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-6-15(8-9-15)10-16-12(17)11(14(3,4)5)13(18)19-7-2/h11H,6-10H2,1-5H3,(H,16,17).
What are the key properties of ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate?
ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate has a molecular weight of 269.38 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1-ethylcyclopropyl)methylcarbamoyl]-3,3-dimethylbutanoate is sourced from PubChem (CID 104918063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).