About N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide
N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide (PubChem CID 10491871) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide |
| PubChem CID | 10491871 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCC[C@H]2C#N)cc1 |
| InChI | InChI=1S/C13H16N2O2S/c1-10-5-7-12(8-6-10)18(16,17)15-13-4-2-3-11(13)9-14/h5-8,11,13,15H,2-4H2,1H3/t11-,13+/m0/s1 |
| InChIKey | VMEHWKYUBRIRFM-WCQYABFASA-N |
| XLogP | 1.97 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide (CID 10491871) is N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N[C@@H]2CCC[C@H]2C#N)cc1.
What is the InChIKey of N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide?
The InChIKey is VMEHWKYUBRIRFM-WCQYABFASA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-10-5-7-12(8-6-10)18(16,17)15-13-4-2-3-11(13)9-14/h5-8,11,13,15H,2-4H2,1H3/t11-,13+/m0/s1.
What are the key properties of N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide?
N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide has a molecular weight of 264.35 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-cyanocyclopentyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 10491871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).