C12H19ClN4O — CID 104918892
6-chloro-2-N-(1-morpholin-4-ylpropan-2-yl)pyridine-2,4-diamine (PubChem CID 104918892) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 6-chloro-2-N-(1-morpholin-4-ylpropan-2-yl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(1-morpholin-4-ylpropan-2-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104918892 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 6-chloro-2-N-(1-morpholin-4-ylpropan-2-yl)pyridine-2,4-diamine |
| SMILES | CC(CN1CCOCC1)Nc1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C12H19ClN4O/c1-9(8-17-2-4-18-5-3-17)15-12-7-10(14)6-11(13)16-12/h6-7,9H,2-5,8H2,1H3,(H3,14,15,16) |
| InChIKey | CUUSVPXPZOVPHP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|