C12H15ClN2O4S — CID 104919448
2-chloro-5-cyano-N-(2,3-dimethoxypropyl)benzenesulfonamide (PubChem CID 104919448) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-(2,3-dimethoxypropyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-cyano-N-(2,3-dimethoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104919448 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-chloro-5-cyano-N-(2,3-dimethoxypropyl)benzenesulfonamide |
| SMILES | COCC(CNS(=O)(=O)c1cc(C#N)ccc1Cl)OC |
| InChI | InChI=1S/C12H15ClN2O4S/c1-18-8-10(19-2)7-15-20(16,17)12-5-9(6-14)3-4-11(12)13/h3-5,10,15H,7-8H2,1-2H3 |
| InChIKey | MGOUGJMIXNJEKM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |