C10H17N5O — CID 104919456
2-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pentanamide (PubChem CID 104919456) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pentanamide.
| Compound Name | 2-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pentanamide |
|---|---|
| PubChem CID | 104919456 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)pentanamide |
| SMILES | CCCC(N)C(=O)Nc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C10H17N5O/c1-4-5-8(11)9(16)13-10-12-6(2)7(3)14-15-10/h8H,4-5,11H2,1-3H3,(H,12,13,15,16) |
| InChIKey | KJFDBCDOCBDAQO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |