About 2-amino-N-(1,2,4-triazin-3-yl)pentanamide
2-amino-N-(1,2,4-triazin-3-yl)pentanamide (PubChem CID 104919503) has the molecular formula C8H13N5O
and a molecular weight of 195.23 g/mol. Its IUPAC name is 2-amino-N-(1,2,4-triazin-3-yl)pentanamide.
Molecular Properties
| Compound Name | 2-amino-N-(1,2,4-triazin-3-yl)pentanamide |
| PubChem CID | 104919503 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-amino-N-(1,2,4-triazin-3-yl)pentanamide |
| SMILES | CCCC(N)C(=O)Nc1nccnn1 |
| InChI | InChI=1S/C8H13N5O/c1-2-3-6(9)7(14)12-8-10-4-5-11-13-8/h4-6H,2-3,9H2,1H3,(H,10,12,13,14) |
| InChIKey | HLCFTWYVSVNMGL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(1,2,4-triazin-3-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(1,2,4-triazin-3-yl)pentanamide?
The IUPAC name of 2-amino-N-(1,2,4-triazin-3-yl)pentanamide (CID 104919503) is 2-amino-N-(1,2,4-triazin-3-yl)pentanamide.
What is the SMILES notation for 2-amino-N-(1,2,4-triazin-3-yl)pentanamide?
The canonical SMILES for 2-amino-N-(1,2,4-triazin-3-yl)pentanamide is CCCC(N)C(=O)Nc1nccnn1.
What is the InChIKey of 2-amino-N-(1,2,4-triazin-3-yl)pentanamide?
The InChIKey is HLCFTWYVSVNMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O/c1-2-3-6(9)7(14)12-8-10-4-5-11-13-8/h4-6H,2-3,9H2,1H3,(H,10,12,13,14).
What are the key properties of 2-amino-N-(1,2,4-triazin-3-yl)pentanamide?
2-amino-N-(1,2,4-triazin-3-yl)pentanamide has a molecular weight of 195.23 g/mol, XLogP of -0.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(1,2,4-triazin-3-yl)pentanamide is sourced from PubChem (CID 104919503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).