C9H15N5O — CID 104919525
(2S)-2-amino-3-methyl-N-(1,2,4-triazin-3-yl)pentanamide (PubChem CID 104919525) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-(1,2,4-triazin-3-yl)pentanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-(1,2,4-triazin-3-yl)pentanamide |
|---|---|
| PubChem CID | 104919525 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-(1,2,4-triazin-3-yl)pentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1nccnn1 |
| InChI | InChI=1S/C9H15N5O/c1-3-6(2)7(10)8(15)13-9-11-4-5-12-14-9/h4-7H,3,10H2,1-2H3,(H,11,13,14,15)/t6?,7-/m0/s1 |
| InChIKey | MBOMPEWTWTUDEI-MLWJPKLSSA-N |
| XLogP | 0.18 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |