C14H21N3O4 — CID 104920889
2-ethyl-4-[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]but-2-enoic acid (PubChem CID 104920889) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-ethyl-4-[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]but-2-enoic acid.
| Compound Name | 2-ethyl-4-[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 104920889 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-ethyl-4-[4-[2-methoxyethyl(methyl)amino]-6-oxopyridazin-1-yl]but-2-enoic acid |
| SMILES | CCC(=CCn1ncc(N(C)CCOC)cc1=O)C(=O)O |
| InChI | InChI=1S/C14H21N3O4/c1-4-11(14(19)20)5-6-17-13(18)9-12(10-15-17)16(2)7-8-21-3/h5,9-10H,4,6-8H2,1-3H3,(H,19,20) |
| InChIKey | ZBVLYDBEDLGQSN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|