C12H22N2O — CID 104921241
(2S)-2-amino-3,3-dimethyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (PubChem CID 104921241) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
| Compound Name | (2S)-2-amino-3,3-dimethyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 104921241 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| SMILES | CC1=CCN(C(=O)[C@@H](N)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N2O/c1-9-5-7-14(8-6-9)11(15)10(13)12(2,3)4/h5,10H,6-8,13H2,1-4H3/t10-/m1/s1 |
| InChIKey | NDBCOQGFZGFREE-SNVBAGLBSA-N |
| XLogP | 1.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|