C10H18N2O — CID 104921248
(2S)-2-amino-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (PubChem CID 104921248) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (2S)-2-amino-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
| Compound Name | (2S)-2-amino-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 104921248 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (2S)-2-amino-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| SMILES | CC[C@H](N)C(=O)N1CC=C(C)CC1 |
| InChI | InChI=1S/C10H18N2O/c1-3-9(11)10(13)12-6-4-8(2)5-7-12/h4,9H,3,5-7,11H2,1-2H3/t9-/m0/s1 |
| InChIKey | MCNIRTULOXNUOX-VIFPVBQESA-N |
| XLogP | 0.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|