C14H16N6 — CID 10492125
(1S,2R,6S,7R)-5-(benzotriazol-1-ylmethyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 10492125) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-(benzotriazol-1-ylmethyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-ene.
| Compound Name | (1S,2R,6S,7R)-5-(benzotriazol-1-ylmethyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-ene |
|---|---|
| PubChem CID | 10492125 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (1S,2R,6S,7R)-5-(benzotriazol-1-ylmethyl)-3,4,5-triazatricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | c1ccc2c(c1)nnn2CN1N=N[C@@H]2[C@H]3CC[C@H](C3)[C@@H]21 |
| InChI | InChI=1S/C14H16N6/c1-2-4-12-11(3-1)15-17-19(12)8-20-14-10-6-5-9(7-10)13(14)16-18-20/h1-4,9-10,13-14H,5-8H2/t9-,10+,13+,14-/m0/s1 |
| InChIKey | QIPCAVLHNCWDKK-PJQZNRQZSA-N |
| XLogP | 2.24 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |