C9H17N3O — CID 104921688
5-(but-3-yn-2-ylamino)-N'-hydroxypentanimidamide (PubChem CID 104921688) has the molecular formula C9H17N3O and a molecular weight of 183.26 g/mol. Its IUPAC name is 5-(but-3-yn-2-ylamino)-N'-hydroxypentanimidamide.
| Compound Name | 5-(but-3-yn-2-ylamino)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 104921688 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 5-(but-3-yn-2-ylamino)-N'-hydroxypentanimidamide |
| SMILES | C#CC(C)NCCCCC(N)=NO |
| InChI | InChI=1S/C9H17N3O/c1-3-8(2)11-7-5-4-6-9(10)12-13/h1,8,11,13H,4-7H2,2H3,(H2,10,12) |
| InChIKey | RSZNCBRKLJLIEG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|