About 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline
4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline (PubChem CID 104921699) has the molecular formula C12H12BrClN2S
and a molecular weight of 331.67 g/mol. Its IUPAC name is 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline |
| PubChem CID | 104921699 |
| Molecular Formula | C12H12BrClN2S |
| Molecular Weight | 331.67 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1NCc1ncc(Cl)s1 |
| InChI | InChI=1S/C12H12BrClN2S/c1-7-3-9(13)4-8(2)12(7)16-6-11-15-5-10(14)17-11/h3-5,16H,6H2,1-2H3 |
| InChIKey | ZNBSHILWRLOGGL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline?
The IUPAC name of 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline (CID 104921699) is 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline.
What is the SMILES notation for 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline?
The canonical SMILES for 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline is Cc1cc(Br)cc(C)c1NCc1ncc(Cl)s1.
What is the InChIKey of 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline?
The InChIKey is ZNBSHILWRLOGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClN2S/c1-7-3-9(13)4-8(2)12(7)16-6-11-15-5-10(14)17-11/h3-5,16H,6H2,1-2H3.
What are the key properties of 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline?
4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline has a molecular weight of 331.67 g/mol, XLogP of 4.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,6-dimethylaniline is sourced from PubChem (CID 104921699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).