About 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide
2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide (PubChem CID 104922455) has the molecular formula C10H13Cl2NO3S2
and a molecular weight of 330.26 g/mol. Its IUPAC name is 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide |
| PubChem CID | 104922455 |
| Molecular Formula | C10H13Cl2NO3S2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCC[C@H]1O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H13Cl2NO3S2/c11-9-5-8(10(12)17-9)18(15,16)13-6-3-1-2-4-7(6)14/h5-7,13-14H,1-4H2/t6-,7-/m1/s1 |
| InChIKey | PUZVBUGCPVYJOB-RNFRBKRXSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide?
The IUPAC name of 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide (CID 104922455) is 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide.
What is the SMILES notation for 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide?
The canonical SMILES for 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide is O=S(=O)(N[C@@H]1CCCC[C@H]1O)c1cc(Cl)sc1Cl.
What is the InChIKey of 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide?
The InChIKey is PUZVBUGCPVYJOB-RNFRBKRXSA-N. The full InChI is InChI=1S/C10H13Cl2NO3S2/c11-9-5-8(10(12)17-9)18(15,16)13-6-3-1-2-4-7(6)14/h5-7,13-14H,1-4H2/t6-,7-/m1/s1.
What are the key properties of 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide?
2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide has a molecular weight of 330.26 g/mol, XLogP of 2.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-N-[(1R,2R)-2-hydroxycyclohexyl]thiophene-3-sulfonamide is sourced from PubChem (CID 104922455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).