C13H23NO — CID 104923298
trans-(1R,2R)-2-(cyclohex-3-en-1-ylmethylamino)cyclohexan-1-ol (PubChem CID 104923298) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is trans-(1R,2R)-2-(cyclohex-3-en-1-ylmethylamino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(cyclohex-3-en-1-ylmethylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 104923298 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | trans-(1R,2R)-2-(cyclohex-3-en-1-ylmethylamino)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1NCC1CC=CCC1 |
| InChI | InChI=1S/C13H23NO/c15-13-9-5-4-8-12(13)14-10-11-6-2-1-3-7-11/h1-2,11-15H,3-10H2/t11?,12-,13-/m1/s1 |
| InChIKey | GMSUKELKMRJWFW-VFRRUGBOSA-N |
| XLogP | 2.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|