C14H21N3O2 — CID 104923328
4-[[[2-[ethyl(methyl)amino]-2-oxoethyl]amino]methyl]-N-methylbenzamide (PubChem CID 104923328) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[[[2-[ethyl(methyl)amino]-2-oxoethyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[2-[ethyl(methyl)amino]-2-oxoethyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 104923328 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-[[[2-[ethyl(methyl)amino]-2-oxoethyl]amino]methyl]-N-methylbenzamide |
| SMILES | CCN(C)C(=O)CNCc1ccc(C(=O)NC)cc1 |
| InChI | InChI=1S/C14H21N3O2/c1-4-17(3)13(18)10-16-9-11-5-7-12(8-6-11)14(19)15-2/h5-8,16H,4,9-10H2,1-3H3,(H,15,19) |
| InChIKey | RUEVPQUJEQCDOC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |