C11H20N4O — CID 104924108
N-(5-methoxypentyl)-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 104924108) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(5-methoxypentyl)-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(5-methoxypentyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 104924108 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-(5-methoxypentyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | COCCCCCNc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C11H20N4O/c1-9-10(2)14-15-11(13-9)12-7-5-4-6-8-16-3/h4-8H2,1-3H3,(H,12,13,15) |
| InChIKey | PVXTZLHMOLZTSI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|